C21H32N2O — CID 42794643
1-[(1-benzylpyrrol-2-yl)methyl-(3-methylbutyl)amino]butan-2-ol (PubChem CID 42794643) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-[(1-benzylpyrrol-2-yl)methyl-(3-methylbutyl)amino]butan-2-ol.
| Compound Name | 1-[(1-benzylpyrrol-2-yl)methyl-(3-methylbutyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 42794643 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 1-[(1-benzylpyrrol-2-yl)methyl-(3-methylbutyl)amino]butan-2-ol |
| SMILES | CCC(O)CN(CCC(C)C)Cc1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C21H32N2O/c1-4-21(24)17-22(14-12-18(2)3)16-20-11-8-13-23(20)15-19-9-6-5-7-10-19/h5-11,13,18,21,24H,4,12,14-17H2,1-3H3 |
| InChIKey | LPGSIXKCFOERMN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |