C24H30N2O — CID 7409827
(2R)-1-[benzyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]butan-2-ol (PubChem CID 7409827) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is (2R)-1-[benzyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]butan-2-ol.
| Compound Name | (2R)-1-[benzyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 7409827 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | (2R)-1-[benzyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]butan-2-ol |
| SMILES | CC[C@@H](O)CN(Cc1ccccc1)Cc1cccn1Cc1ccccc1C |
| InChI | InChI=1S/C24H30N2O/c1-3-24(27)19-25(16-21-11-5-4-6-12-21)18-23-14-9-15-26(23)17-22-13-8-7-10-20(22)2/h4-15,24,27H,3,16-19H2,1-2H3/t24-/m1/s1 |
| InChIKey | NEARVSSMWZBJSH-XMMPIXPASA-N |
| XLogP | 4.62 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |