C21H30N2O — CID 42794850
1-[cyclopropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-3-methylbutan-2-ol (PubChem CID 42794850) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 1-[cyclopropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-3-methylbutan-2-ol.
| Compound Name | 1-[cyclopropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 42794850 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 1-[cyclopropyl-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl]amino]-3-methylbutan-2-ol |
| SMILES | Cc1ccccc1Cn1cccc1CN(CC(O)C(C)C)C1CC1 |
| InChI | InChI=1S/C21H30N2O/c1-16(2)21(24)15-23(19-10-11-19)14-20-9-6-12-22(20)13-18-8-5-4-7-17(18)3/h4-9,12,16,19,21,24H,10-11,13-15H2,1-3H3 |
| InChIKey | ADIMUAZPSKRRLY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |