C22H34N2O — CID 42794839
3-methyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]butan-2-ol (PubChem CID 42794839) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is 3-methyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]butan-2-ol.
| Compound Name | 3-methyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 42794839 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 3-methyl-1-[[1-[(2-methylphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]butan-2-ol |
| SMILES | Cc1ccccc1Cn1cccc1CN(CC(C)C)CC(O)C(C)C |
| InChI | InChI=1S/C22H34N2O/c1-17(2)13-23(16-22(25)18(3)4)15-21-11-8-12-24(21)14-20-10-7-6-9-19(20)5/h6-12,17-18,22,25H,13-16H2,1-5H3 |
| InChIKey | ANFHPRXZNXICNX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |