C22H32N2O4 — CID 7418940
[(2R)-3-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-hydroxypropyl] butanoate (PubChem CID 7418940) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [(2R)-3-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-hydroxypropyl] butanoate.
| Compound Name | [(2R)-3-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-hydroxypropyl] butanoate |
|---|---|
| PubChem CID | 7418940 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [(2R)-3-[(1-benzylpyrrol-2-yl)methyl-(2-methoxyethyl)amino]-2-hydroxypropyl] butanoate |
| SMILES | CCCC(=O)OC[C@H](O)CN(CCOC)Cc1cccn1Cc1ccccc1 |
| InChI | InChI=1S/C22H32N2O4/c1-3-8-22(26)28-18-21(25)17-23(13-14-27-2)16-20-11-7-12-24(20)15-19-9-5-4-6-10-19/h4-7,9-12,21,25H,3,8,13-18H2,1-2H3/t21-/m1/s1 |
| InChIKey | NCBZLPKCCYOCDE-OAQYLSRUSA-N |
| XLogP | 2.69 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |