C16H28N2O4 — CID 24715498
[2-hydroxy-3-[2-methoxyethyl-[(1-methylpyrrol-2-yl)methyl]amino]propyl] butanoate (PubChem CID 24715498) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is [2-hydroxy-3-[2-methoxyethyl-[(1-methylpyrrol-2-yl)methyl]amino]propyl] butanoate.
| Compound Name | [2-hydroxy-3-[2-methoxyethyl-[(1-methylpyrrol-2-yl)methyl]amino]propyl] butanoate |
|---|---|
| PubChem CID | 24715498 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [2-hydroxy-3-[2-methoxyethyl-[(1-methylpyrrol-2-yl)methyl]amino]propyl] butanoate |
| SMILES | CCCC(=O)OCC(O)CN(CCOC)Cc1cccn1C |
| InChI | InChI=1S/C16H28N2O4/c1-4-6-16(20)22-13-15(19)12-18(9-10-21-3)11-14-7-5-8-17(14)2/h5,7-8,15,19H,4,6,9-13H2,1-3H3 |
| InChIKey | GTZLLSPIMMGDHY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |