C18H29NO4 — CID 93162735
[(2S)-2-hydroxy-3-[2-methoxyethyl-[(2-methylphenyl)methyl]amino]propyl] butanoate (PubChem CID 93162735) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-[2-methoxyethyl-[(2-methylphenyl)methyl]amino]propyl] butanoate.
| Compound Name | [(2S)-2-hydroxy-3-[2-methoxyethyl-[(2-methylphenyl)methyl]amino]propyl] butanoate |
|---|---|
| PubChem CID | 93162735 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | [(2S)-2-hydroxy-3-[2-methoxyethyl-[(2-methylphenyl)methyl]amino]propyl] butanoate |
| SMILES | CCCC(=O)OC[C@@H](O)CN(CCOC)Cc1ccccc1C |
| InChI | InChI=1S/C18H29NO4/c1-4-7-18(21)23-14-17(20)13-19(10-11-22-3)12-16-9-6-5-8-15(16)2/h5-6,8-9,17,20H,4,7,10-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | BQGOCEOYOCOTQJ-KRWDZBQOSA-N |
| XLogP | 2.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |