C24H36FN3O2+2 — CID 7410788
[1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxyhex-5-enyl]-(2-morpholin-4-ium-4-ylethyl)azanium (PubChem CID 7410788) has the molecular formula C24H36FN3O2+2 and a molecular weight of 417.57 g/mol. Its IUPAC name is [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxyhex-5-enyl]-(2-morpholin-4-ium-4-ylethyl)azanium.
| Compound Name | [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxyhex-5-enyl]-(2-morpholin-4-ium-4-ylethyl)azanium |
|---|---|
| PubChem CID | 7410788 |
| Molecular Formula | C24H36FN3O2+2 |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | [1-[(3-fluorophenyl)methyl]pyrrol-2-yl]methyl-[(2R)-2-hydroxyhex-5-enyl]-(2-morpholin-4-ium-4-ylethyl)azanium |
| SMILES | C=CCC[C@@H](O)C[NH+](CC[NH+]1CCOCC1)Cc1cccn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H34FN3O2/c1-2-3-9-24(29)20-27(12-11-26-13-15-30-16-14-26)19-23-8-5-10-28(23)18-21-6-4-7-22(25)17-21/h2,4-8,10,17,24,29H,1,3,9,11-16,18-20H2/p+2/t24-/m1/s1 |
| InChIKey | GAROFGJHUZCSTN-XMMPIXPASA-P |
| XLogP | 0.30 |
| TPSA | 43.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|