C27H42N2O2 — CID 98623099
(2R)-1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-3-methylbutan-2-yl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 98623099) has the molecular formula C27H42N2O2 and a molecular weight of 426.65 g/mol. Its IUPAC name is (2R)-1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-3-methylbutan-2-yl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-3-methylbutan-2-yl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 98623099 |
| Molecular Formula | C27H42N2O2 |
| Molecular Weight | 426.65 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (2R)-1-[[1-[(4-tert-butylphenyl)methyl]pyrrol-2-yl]methyl-[(2R)-3-methylbutan-2-yl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN(Cc1cccn1Cc1ccc(C(C)(C)C)cc1)[C@H](C)C(C)C |
| InChI | InChI=1S/C27H42N2O2/c1-8-16-31-20-26(30)19-29(22(4)21(2)3)18-25-10-9-15-28(25)17-23-11-13-24(14-12-23)27(5,6)7/h8-15,21-22,26,30H,1,16-20H2,2-7H3/t22-,26-/m1/s1 |
| InChIKey | NFTQYVKTVWIWRA-ATIYNZHBSA-N |
| XLogP | 5.24 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|