C23H26ClFN2O2 — CID 98629783
(2R)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(4-fluorophenyl)methyl]amino]hex-5-en-2-ol (PubChem CID 98629783) has the molecular formula C23H26ClFN2O2 and a molecular weight of 416.92 g/mol. Its IUPAC name is (2R)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(4-fluorophenyl)methyl]amino]hex-5-en-2-ol.
| Compound Name | (2R)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(4-fluorophenyl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 98629783 |
| Molecular Formula | C23H26ClFN2O2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2R)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-[(4-fluorophenyl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@@H](O)CN(Cc1ccc(F)cc1)C[C@H]1CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C23H26ClFN2O2/c1-2-3-4-21(28)15-27(14-17-5-11-20(25)12-6-17)16-22-13-23(26-29-22)18-7-9-19(24)10-8-18/h2,5-12,21-22,28H,1,3-4,13-16H2/t21-,22-/m1/s1 |
| InChIKey | XSDSKALTTVZUEE-FGZHOGPDSA-N |
| XLogP | 4.80 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|