C16H21ClN2O2 — CID 98629906
(2S)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylamino]propan-2-ol (PubChem CID 98629906) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is (2S)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylamino]propan-2-ol.
| Compound Name | (2S)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylamino]propan-2-ol |
|---|---|
| PubChem CID | 98629906 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (2S)-1-[[(5R)-3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-prop-2-enylamino]propan-2-ol |
| SMILES | C=CCN(C[C@H]1CC(c2ccc(Cl)cc2)=NO1)C[C@H](C)O |
| InChI | InChI=1S/C16H21ClN2O2/c1-3-8-19(10-12(2)20)11-15-9-16(18-21-15)13-4-6-14(17)7-5-13/h3-7,12,15,20H,1,8-11H2,2H3/t12-,15+/m0/s1 |
| InChIKey | ZGJVNCWXLWTILY-SWLSCSKDSA-N |
| XLogP | 2.70 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|