C18H26O2 — CID 142470151
5-(3,6,7-trimethyloct-6-enyl)-1,3-benzodioxole (PubChem CID 142470151) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 5-(3,6,7-trimethyloct-6-enyl)-1,3-benzodioxole.
| Compound Name | 5-(3,6,7-trimethyloct-6-enyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 142470151 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 5-(3,6,7-trimethyloct-6-enyl)-1,3-benzodioxole |
| SMILES | CC(C)=C(C)CCC(C)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H26O2/c1-13(2)15(4)7-5-14(3)6-8-16-9-10-17-18(11-16)20-12-19-17/h9-11,14H,5-8,12H2,1-4H3 |
| InChIKey | ZOGXILUKRTXXJP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|