C13H16O2S2 — CID 163664812
10-prop-2-enyl-2,3,6,7-tetrahydro-1,8,4,5-benzodioxadithiecine (PubChem CID 163664812) has the molecular formula C13H16O2S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 10-prop-2-enyl-2,3,6,7-tetrahydro-1,8,4,5-benzodioxadithiecine.
| Compound Name | 10-prop-2-enyl-2,3,6,7-tetrahydro-1,8,4,5-benzodioxadithiecine |
|---|---|
| PubChem CID | 163664812 |
| Molecular Formula | C13H16O2S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 10-prop-2-enyl-2,3,6,7-tetrahydro-1,8,4,5-benzodioxadithiecine |
| SMILES | C=CCc1ccc2c(c1)OCCSSCCO2 |
| InChI | InChI=1S/C13H16O2S2/c1-2-3-11-4-5-12-13(10-11)15-7-9-17-16-8-6-14-12/h2,4-5,10H,1,3,6-9H2 |
| InChIKey | IXLLOZPIQYZPBJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|