C11H11ClO2 — CID 154260196
2-(chloromethyl)-5-prop-2-enyl-1,3-benzodioxole (PubChem CID 154260196) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-(chloromethyl)-5-prop-2-enyl-1,3-benzodioxole.
| Compound Name | 2-(chloromethyl)-5-prop-2-enyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 154260196 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 2-(chloromethyl)-5-prop-2-enyl-1,3-benzodioxole |
| SMILES | C=CCc1ccc2c(c1)OC(CCl)O2 |
| InChI | InChI=1S/C11H11ClO2/c1-2-3-8-4-5-9-10(6-8)14-11(7-12)13-9/h2,4-6,11H,1,3,7H2 |
| InChIKey | HTURJQIIVUAAFM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|