C15H18O3 — CID 129262168
1-[(2R)-5-[(E)-hex-2-enyl]-1,3-benzodioxol-2-yl]ethanone (PubChem CID 129262168) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-[(2R)-5-[(E)-hex-2-enyl]-1,3-benzodioxol-2-yl]ethanone.
| Compound Name | 1-[(2R)-5-[(E)-hex-2-enyl]-1,3-benzodioxol-2-yl]ethanone |
|---|---|
| PubChem CID | 129262168 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-[(2R)-5-[(E)-hex-2-enyl]-1,3-benzodioxol-2-yl]ethanone |
| SMILES | CCC/C=C/Cc1ccc2c(c1)O[C@H](C(C)=O)O2 |
| InChI | InChI=1S/C15H18O3/c1-3-4-5-6-7-12-8-9-13-14(10-12)18-15(17-13)11(2)16/h5-6,8-10,15H,3-4,7H2,1-2H3/b6-5+/t15-/m1/s1 |
| InChIKey | WFNBHSWRACPZRO-LLYBFZRZSA-N |
| XLogP | 3.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|