C21H24O5 — CID 162788288
(2R,3R)-2-methyl-6-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 162788288) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is (2R,3R)-2-methyl-6-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | (2R,3R)-2-methyl-6-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 162788288 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2R,3R)-2-methyl-6-prop-2-enyl-3-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | C=CCc1ccc2c(c1)O[C@H](c1cc(OC)c(OC)c(OC)c1)[C@@H](C)O2 |
| InChI | InChI=1S/C21H24O5/c1-6-7-14-8-9-16-17(10-14)26-20(13(2)25-16)15-11-18(22-3)21(24-5)19(12-15)23-4/h6,8-13,20H,1,7H2,2-5H3/t13-,20+/m1/s1 |
| InChIKey | WXMBHKUHLKFVCT-XCLFUZPHSA-N |
| XLogP | 4.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|