C13H14O2 — CID 10910586
3-methylidene-7-prop-2-enyl-1,5-benzodioxepine (PubChem CID 10910586) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 3-methylidene-7-prop-2-enyl-1,5-benzodioxepine.
| Compound Name | 3-methylidene-7-prop-2-enyl-1,5-benzodioxepine |
|---|---|
| PubChem CID | 10910586 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-methylidene-7-prop-2-enyl-1,5-benzodioxepine |
| SMILES | C=CCc1ccc2c(c1)OCC(=C)CO2 |
| InChI | InChI=1S/C13H14O2/c1-3-4-11-5-6-12-13(7-11)15-9-10(2)8-14-12/h3,5-7H,1-2,4,8-9H2 |
| InChIKey | BOVGHIXVRUKDIH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|