C18H21N5O4 — CID 67373427
2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,5-dimethoxyphenyl)guanidine (PubChem CID 67373427) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,5-dimethoxyphenyl)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,5-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 67373427 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(diaminomethylidene)-3-(3,5-dimethoxyphenyl)guanidine |
| SMILES | COc1cc(N/C(N=C(N)N)=N\Cc2ccc3c(c2)OCO3)cc(OC)c1 |
| InChI | InChI=1S/C18H21N5O4/c1-24-13-6-12(7-14(8-13)25-2)22-18(23-17(19)20)21-9-11-3-4-15-16(5-11)27-10-26-15/h3-8H,9-10H2,1-2H3,(H5,19,20,21,22,23) |
| InChIKey | FSGMPIZFYINOAM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|