C13H20BrN3O — CID 75364739
2-[(3-bromophenyl)methyl]-1-(3-ethoxypropyl)guanidine (PubChem CID 75364739) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-1-(3-ethoxypropyl)guanidine.
| Compound Name | 2-[(3-bromophenyl)methyl]-1-(3-ethoxypropyl)guanidine |
|---|---|
| PubChem CID | 75364739 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-1-(3-ethoxypropyl)guanidine |
| SMILES | CCOCCCN/C(N)=N/Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H20BrN3O/c1-2-18-8-4-7-16-13(15)17-10-11-5-3-6-12(14)9-11/h3,5-6,9H,2,4,7-8,10H2,1H3,(H3,15,16,17) |
| InChIKey | VTCMLJNKFOCZCN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|