C21H27ClIN5O2 — CID 111293574
N-(2-amino-2-oxoethyl)-4-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111293574) has the molecular formula C21H27ClIN5O2 and a molecular weight of 543.84 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111293574 |
| Molecular Formula | C21H27ClIN5O2 |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)N(C)Cc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C21H26ClN5O2.HI/c1-3-24-21(27(2)14-16-6-10-18(22)11-7-16)26-12-15-4-8-17(9-5-15)20(29)25-13-19(23)28;/h4-11H,3,12-14H2,1-2H3,(H2,23,28)(H,24,26)(H,25,29);1H |
| InChIKey | SYHFHBPZLLOJIB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|