C22H29ClIN5O3 — CID 111680813
N-(2-amino-2-oxoethyl)-4-[[[[2-(4-chlorophenoxy)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111680813) has the molecular formula C22H29ClIN5O3 and a molecular weight of 573.86 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[[2-(4-chlorophenoxy)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[[2-(4-chlorophenoxy)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111680813 |
| Molecular Formula | C22H29ClIN5O3 |
| Molecular Weight | 573.86 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[[2-(4-chlorophenoxy)propylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NCC(C)Oc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C22H28ClN5O3.HI/c1-3-25-22(27-12-15(2)31-19-10-8-18(23)9-11-19)28-13-16-4-6-17(7-5-16)21(30)26-14-20(24)29;/h4-11,15H,3,12-14H2,1-2H3,(H2,24,29)(H,26,30)(H2,25,27,28);1H |
| InChIKey | RPOMWKOBYPKUQP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|