C20H26ClIN4O2 — CID 111984216
2-[3-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111984216) has the molecular formula C20H26ClIN4O2 and a molecular weight of 516.81 g/mol. Its IUPAC name is 2-[3-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111984216 |
| Molecular Formula | C20H26ClIN4O2 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-[3-[[[[(4-chlorophenyl)methyl-methylamino]-(ethylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)N(C)Cc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C20H25ClN4O2.HI/c1-3-23-20(25(2)13-15-7-9-17(21)10-8-15)24-12-16-5-4-6-18(11-16)27-14-19(22)26;/h4-11H,3,12-14H2,1-2H3,(H2,22,26)(H,23,24);1H |
| InChIKey | GIHDZAVOXWNJJE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|