C18H27IN6O2 — CID 111984812
2-[3-[[[ethylamino-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111984812) has the molecular formula C18H27IN6O2 and a molecular weight of 486.36 g/mol. Its IUPAC name is 2-[3-[[[ethylamino-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[ethylamino-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111984812 |
| Molecular Formula | C18H27IN6O2 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 2-[3-[[[ethylamino-[methyl-[(1-methylpyrazol-4-yl)methyl]amino]methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)N(C)Cc1cnn(C)c1.I |
| InChI | InChI=1S/C18H26N6O2.HI/c1-4-20-18(23(2)11-15-10-22-24(3)12-15)21-9-14-6-5-7-16(8-14)26-13-17(19)25;/h5-8,10,12H,4,9,11,13H2,1-3H3,(H2,19,25)(H,20,21);1H |
| InChIKey | DLYQIUQTSHACKT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|