C20H27Cl2IN6O — CID 111742502
3,4-dichloro-N-[2-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]ethyl]benzamide;hydroiodide (PubChem CID 111742502) has the molecular formula C20H27Cl2IN6O and a molecular weight of 565.29 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3,4-dichloro-N-[2-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111742502 |
| Molecular Formula | C20H27Cl2IN6O |
| Molecular Weight | 565.29 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 3,4-dichloro-N-[2-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]ethyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\CCNC(=O)c1ccc(Cl)c(Cl)c1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C20H26Cl2N6O.HI/c1-3-23-20(28-9-6-15(13-28)16-11-26-27(2)12-16)25-8-7-24-19(29)14-4-5-17(21)18(22)10-14;/h4-5,10-12,15H,3,6-9,13H2,1-2H3,(H,23,25)(H,24,29);1H |
| InChIKey | DQAWJBKTUCVTDP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|