C21H29ClN6O — CID 111740780
N-(3-chloro-2-methylphenyl)-3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propanamide (PubChem CID 111740780) has the molecular formula C21H29ClN6O and a molecular weight of 416.96 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111740780 |
| Molecular Formula | C21H29ClN6O |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1cccc(Cl)c1C)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C21H29ClN6O/c1-4-23-21(28-11-9-16(14-28)17-12-25-27(3)13-17)24-10-8-20(29)26-19-7-5-6-18(22)15(19)2/h5-7,12-13,16H,4,8-11,14H2,1-3H3,(H,23,24)(H,26,29) |
| InChIKey | FAHZAYWUCBZKPV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|