C21H32ClN5O2 — CID 111726029
N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propanamide (PubChem CID 111726029) has the molecular formula C21H32ClN5O2 and a molecular weight of 421.97 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111726029 |
| Molecular Formula | C21H32ClN5O2 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1cccc(Cl)c1C)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C21H32ClN5O2/c1-3-23-21(27-10-8-17(15-27)26-11-13-29-14-12-26)24-9-7-20(28)25-19-6-4-5-18(22)16(19)2/h4-6,17H,3,7-15H2,1-2H3,(H,23,24)(H,25,28) |
| InChIKey | OOBYZHGCABKTQS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|