C21H28ClN7O — CID 111207614
N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanamide (PubChem CID 111207614) has the molecular formula C21H28ClN7O and a molecular weight of 429.96 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanamide |
|---|---|
| PubChem CID | 111207614 |
| Molecular Formula | C21H28ClN7O |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]propanamide |
| SMILES | CCN/C(=N\CCC(=O)Nc1cccc(Cl)c1C)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H28ClN7O/c1-3-23-20(28-12-14-29(15-13-28)21-24-9-5-10-25-21)26-11-8-19(30)27-18-7-4-6-17(22)16(18)2/h4-7,9-10H,3,8,11-15H2,1-2H3,(H,23,26)(H,27,30) |
| InChIKey | VDJCBKMIEQHYCI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|