C15H21ClN4OS — CID 111092466
3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide (PubChem CID 111092466) has the molecular formula C15H21ClN4OS and a molecular weight of 340.88 g/mol. Its IUPAC name is 3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide.
| Compound Name | 3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 111092466 |
| Molecular Formula | C15H21ClN4OS |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CC/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C15H21ClN4OS/c1-11-12(16)3-2-4-13(11)19-14(21)5-6-18-15(17)20-7-9-22-10-8-20/h2-4H,5-10H2,1H3,(H2,17,18)(H,19,21) |
| InChIKey | AWQZPOBMCYRUCD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|