C17H25ClN4O — CID 111092452
3-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide (PubChem CID 111092452) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is 3-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide.
| Compound Name | 3-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 111092452 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-[[amino-(3-methylpiperidin-1-yl)methylidene]amino]-N-(3-chloro-2-methylphenyl)propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CC/N=C(\N)N1CCCC(C)C1 |
| InChI | InChI=1S/C17H25ClN4O/c1-12-5-4-10-22(11-12)17(19)20-9-8-16(23)21-15-7-3-6-14(18)13(15)2/h3,6-7,12H,4-5,8-11H2,1-2H3,(H2,19,20)(H,21,23) |
| InChIKey | KPHCTSVLWZAPNY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|