C18H24ClN3O2 — CID 5427907
N-(3-chloro-2-methylphenyl)-N'-[(Z)-[(3S)-3-methylcyclohexylidene]amino]butanediamide (PubChem CID 5427907) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-N'-[(Z)-[(3S)-3-methylcyclohexylidene]amino]butanediamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-[(3S)-3-methylcyclohexylidene]amino]butanediamide |
|---|---|
| PubChem CID | 5427907 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-N'-[(Z)-[(3S)-3-methylcyclohexylidene]amino]butanediamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCC(=O)N/N=C1/CCC[C@H](C)C1 |
| InChI | InChI=1S/C18H24ClN3O2/c1-12-5-3-6-14(11-12)21-22-18(24)10-9-17(23)20-16-8-4-7-15(19)13(16)2/h4,7-8,12H,3,5-6,9-11H2,1-2H3,(H,20,23)(H,22,24)/b21-14-/t12-/m0/s1 |
| InChIKey | QNDYWEGQHDQNHY-NBMDANRKSA-N |
| XLogP | 4.05 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|