C17H22ClN3O2 — CID 5411162
N-(2-chlorophenyl)-N'-[(Z)-[(2R)-2-ethylcyclopentylidene]amino]butanediamide (PubChem CID 5411162) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(Z)-[(2R)-2-ethylcyclopentylidene]amino]butanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(Z)-[(2R)-2-ethylcyclopentylidene]amino]butanediamide |
|---|---|
| PubChem CID | 5411162 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(Z)-[(2R)-2-ethylcyclopentylidene]amino]butanediamide |
| SMILES | CC[C@@H]1CCC/C1=N/NC(=O)CCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H22ClN3O2/c1-2-12-6-5-9-14(12)20-21-17(23)11-10-16(22)19-15-8-4-3-7-13(15)18/h3-4,7-8,12H,2,5-6,9-11H2,1H3,(H,19,22)(H,21,23)/b20-14-/t12-/m1/s1 |
| InChIKey | PFONKMQGMFULGE-KMCFQHSYSA-N |
| XLogP | 3.74 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|