C19H29IN6OS — CID 111741672
N-[3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide (PubChem CID 111741672) has the molecular formula C19H29IN6OS and a molecular weight of 516.45 g/mol. Its IUPAC name is N-[3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111741672 |
| Molecular Formula | C19H29IN6OS |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | N-[3-[[ethylamino-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]methylidene]amino]propyl]thiophene-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCNC(=O)c1cccs1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C19H28N6OS.HI/c1-3-20-19(22-9-5-8-21-18(26)17-6-4-11-27-17)25-10-7-15(14-25)16-12-23-24(2)13-16;/h4,6,11-13,15H,3,5,7-10,14H2,1-2H3,(H,20,22)(H,21,26);1H |
| InChIKey | QAAFOBHOUNWLCK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|