C19H21Cl2IN4O — CID 111055808
N-[2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide (PubChem CID 111055808) has the molecular formula C19H21Cl2IN4O and a molecular weight of 519.21 g/mol. Its IUPAC name is N-[2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 111055808 |
| Molecular Formula | C19H21Cl2IN4O |
| Molecular Weight | 519.21 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | N-[2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]ethyl]-3,4-dichlorobenzamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccc(Cl)c(Cl)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H20Cl2N4O.HI/c20-16-7-5-14(11-17(16)21)18(26)23-8-9-24-19(22)25-15-6-4-12-2-1-3-13(12)10-15;/h4-7,10-11H,1-3,8-9H2,(H,23,26)(H3,22,24,25);1H |
| InChIKey | GHSUSLJRRLBGKQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|