C22H30IN5O — CID 111087316
3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide (PubChem CID 111087316) has the molecular formula C22H30IN5O and a molecular weight of 507.42 g/mol. Its IUPAC name is 3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide.
| Compound Name | 3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111087316 |
| Molecular Formula | C22H30IN5O |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-[2-(dimethylamino)ethyl]benzamide;hydroiodide |
| SMILES | CN(C)CCNC(=O)c1cccc(C/N=C(\N)Nc2ccc3c(c2)CCC3)c1.I |
| InChI | InChI=1S/C22H29N5O.HI/c1-27(2)12-11-24-21(28)19-8-3-5-16(13-19)15-25-22(23)26-20-10-9-17-6-4-7-18(17)14-20;/h3,5,8-10,13-14H,4,6-7,11-12,15H2,1-2H3,(H,24,28)(H3,23,25,26);1H |
| InChIKey | PCXHDJSFUHNHJQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|