C18H16Cl2N2O2 — CID 42467160
3,4-dichloro-N-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]benzamide (PubChem CID 42467160) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 42467160 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3,4-dichloro-N-[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H16Cl2N2O2/c19-15-7-5-13(9-16(15)20)18(24)21-10-17(23)22-14-6-4-11-2-1-3-12(11)8-14/h4-9H,1-3,10H2,(H,21,24)(H,22,23) |
| InChIKey | MSLZSZZFZYMNSU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |