C18H19Cl2IN6O — CID 111807419
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111807419) has the molecular formula C18H19Cl2IN6O and a molecular weight of 533.20 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807419 |
| Molecular Formula | C18H19Cl2IN6O |
| Molecular Weight | 533.20 g/mol |
| Exact Mass | 532.00 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCc1noc(-c2ccccn2)n1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H18Cl2N6O.HI/c1-11(13-6-5-12(19)10-14(13)20)24-18(21)23-9-7-16-25-17(27-26-16)15-4-2-3-8-22-15;/h2-6,8,10-11H,7,9H2,1H3,(H3,21,23,24);1H |
| InChIKey | DXGQTORGCCAXEE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|