C17H18ClIN6O2 — CID 111807417
1-(3-chloro-4-methoxyphenyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111807417) has the molecular formula C17H18ClIN6O2 and a molecular weight of 500.73 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807417 |
| Molecular Formula | C17H18ClIN6O2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.02 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCc2noc(-c3ccccn3)n2)cc1Cl.I |
| InChI | InChI=1S/C17H17ClN6O2.HI/c1-25-14-6-5-11(10-12(14)18)22-17(19)21-9-7-15-23-16(26-24-15)13-4-2-3-8-20-13;/h2-6,8,10H,7,9H2,1H3,(H3,19,21,22);1H |
| InChIKey | LIVCESHRSYQFDO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|