C16H18ClIN6O2 — CID 111805581
1-(3-chloro-4-methoxyphenyl)-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide (PubChem CID 111805581) has the molecular formula C16H18ClIN6O2 and a molecular weight of 488.72 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111805581 |
| Molecular Formula | C16H18ClIN6O2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCc2nc(-c3ccco3)n[nH]2)cc1Cl.I |
| InChI | InChI=1S/C16H17ClN6O2.HI/c1-24-12-5-4-10(9-11(12)17)20-16(18)19-7-6-14-21-15(23-22-14)13-3-2-8-25-13;/h2-5,8-9H,6-7H2,1H3,(H3,18,19,20)(H,21,22,23);1H |
| InChIKey | ZKYKUUOZSIXOPB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|