C12H17IN6O — CID 111427037
1-cyclopropyl-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide (PubChem CID 111427037) has the molecular formula C12H17IN6O and a molecular weight of 388.21 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111427037 |
| Molecular Formula | C12H17IN6O |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 1-cyclopropyl-2-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1nc(-c2ccco2)n[nH]1)NC1CC1 |
| InChI | InChI=1S/C12H16N6O.HI/c13-12(15-8-3-4-8)14-6-5-10-16-11(18-17-10)9-2-1-7-19-9;/h1-2,7-8H,3-6H2,(H3,13,14,15)(H,16,17,18);1H |
| InChIKey | HNBJHCDGPGHXEE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|