C18H29IN6O — CID 111807391
1-(6-methylheptan-2-yl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111807391) has the molecular formula C18H29IN6O and a molecular weight of 472.38 g/mol. Its IUPAC name is 1-(6-methylheptan-2-yl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(6-methylheptan-2-yl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111807391 |
| Molecular Formula | C18H29IN6O |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 1-(6-methylheptan-2-yl)-2-[2-(5-pyridin-2-yl-1,2,4-oxadiazol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CC(C)CCCC(C)N/C(N)=N/CCc1noc(-c2ccccn2)n1.I |
| InChI | InChI=1S/C18H28N6O.HI/c1-13(2)7-6-8-14(3)22-18(19)21-12-10-16-23-17(25-24-16)15-9-4-5-11-20-15;/h4-5,9,11,13-14H,6-8,10,12H2,1-3H3,(H3,19,21,22);1H |
| InChIKey | RHHGFMDYHDPVGW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|