C20H28Cl2IN7 — CID 111043445
1-[1-(2,4-dichlorophenyl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111043445) has the molecular formula C20H28Cl2IN7 and a molecular weight of 564.30 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111043445 |
| Molecular Formula | C20H28Cl2IN7 |
| Molecular Weight | 564.30 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/CCCN1CCN(c2ncccn2)CC1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C20H27Cl2N7.HI/c1-15(17-5-4-16(21)14-18(17)22)27-19(23)24-8-3-9-28-10-12-29(13-11-28)20-25-6-2-7-26-20;/h2,4-7,14-15H,3,8-13H2,1H3,(H3,23,24,27);1H |
| InChIKey | OHHHDQOOVWZSEW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|