C20H24Cl2FIN4O — CID 111068358
1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111068358) has the molecular formula C20H24Cl2FIN4O and a molecular weight of 553.25 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111068358 |
| Molecular Formula | C20H24Cl2FIN4O |
| Molecular Weight | 553.25 g/mol |
| Exact Mass | 552.04 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CC(N/C(N)=N/Cc1ccc(N2CCOCC2)c(F)c1)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C20H23Cl2FN4O.HI/c1-13(16-4-3-15(21)11-17(16)22)26-20(24)25-12-14-2-5-19(18(23)10-14)27-6-8-28-9-7-27;/h2-5,10-11,13H,6-9,12H2,1H3,(H3,24,25,26);1H |
| InChIKey | KOIUDJXKLRKCCN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|