C23H28Cl2N4O — CID 111310414
1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111310414) has the molecular formula C23H28Cl2N4O and a molecular weight of 447.41 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111310414 |
| Molecular Formula | C23H28Cl2N4O |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-3-ethyl-2-[[4-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCCC2=O)cc1)NC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H28Cl2N4O/c1-3-26-23(28-16(2)20-11-10-19(24)13-21(20)25)27-14-17-6-8-18(9-7-17)15-29-12-4-5-22(29)30/h6-11,13,16H,3-5,12,14-15H2,1-2H3,(H2,26,27,28) |
| InChIKey | KDBMXYPABLJCAY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|