C19H23Cl2IN4O2 — CID 111310625
2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide (PubChem CID 111310625) has the molecular formula C19H23Cl2IN4O2 and a molecular weight of 537.23 g/mol. Its IUPAC name is 2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111310625 |
| Molecular Formula | C19H23Cl2IN4O2 |
| Molecular Weight | 537.23 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-[[[1-(2,4-dichlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-(4-hydroxyphenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(O)cc1)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C19H22Cl2N4O2.HI/c1-3-22-19(24-12(2)16-9-4-13(20)10-17(16)21)23-11-18(27)25-14-5-7-15(26)8-6-14;/h4-10,12,26H,3,11H2,1-2H3,(H,25,27)(H2,22,23,24);1H |
| InChIKey | ADRKYKFRJOSCSX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|