C17H25Cl2IN4O — CID 111310277
1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111310277) has the molecular formula C17H25Cl2IN4O and a molecular weight of 499.22 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111310277 |
| Molecular Formula | C17H25Cl2IN4O |
| Molecular Weight | 499.22 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N1CCCCC1)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H24Cl2N4O.HI/c1-12(14-7-6-13(18)10-15(14)19)22-17(20-2)21-11-16(24)23-8-4-3-5-9-23;/h6-7,10,12H,3-5,8-9,11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | YTXVHSDOEHBECD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|