C13H26N4O — CID 110943728
1-butan-2-yl-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine (PubChem CID 110943728) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-butan-2-yl-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 110943728 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 1-butan-2-yl-2-methyl-3-(2-oxo-2-piperidin-1-ylethyl)guanidine |
| SMILES | CCC(C)N/C(=N\C)NCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H26N4O/c1-4-11(2)16-13(14-3)15-10-12(18)17-8-6-5-7-9-17/h11H,4-10H2,1-3H3,(H2,14,15,16) |
| InChIKey | REHKTGBBERIDOG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|