C18H21Cl2IN4O — CID 111310253
4-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111310253) has the molecular formula C18H21Cl2IN4O and a molecular weight of 507.20 g/mol. Its IUPAC name is 4-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | 4-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111310253 |
| Molecular Formula | C18H21Cl2IN4O |
| Molecular Weight | 507.20 g/mol |
| Exact Mass | 506.01 |
| IUPAC Name | 4-[[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)cc1)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C18H20Cl2N4O.HI/c1-11(15-8-7-14(19)9-16(15)20)24-18(22-2)23-10-12-3-5-13(6-4-12)17(21)25;/h3-9,11H,10H2,1-2H3,(H2,21,25)(H2,22,23,24);1H |
| InChIKey | WXINOMCWWPZEJN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|