C17H19F2IN4O — CID 111903408
4-[[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111903408) has the molecular formula C17H19F2IN4O and a molecular weight of 460.27 g/mol. Its IUPAC name is 4-[[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | 4-[[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111903408 |
| Molecular Formula | C17H19F2IN4O |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-[[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C(N)=O)cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C17H18F2N4O.HI/c1-21-17(23-10-13-8-14(18)6-7-15(13)19)22-9-11-2-4-12(5-3-11)16(20)24;/h2-8H,9-10H2,1H3,(H2,20,24)(H2,21,22,23);1H |
| InChIKey | PJWJFVFREYTVFK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|