C15H23Cl2IN4O — CID 111310407
3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111310407) has the molecular formula C15H23Cl2IN4O and a molecular weight of 473.19 g/mol. Its IUPAC name is 3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111310407 |
| Molecular Formula | C15H23Cl2IN4O |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 3-[[N-[1-(2,4-dichlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NC(C)c1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C15H22Cl2N4O.HI/c1-10(12-6-5-11(16)9-13(12)17)20-15(18-2)19-8-7-14(22)21(3)4;/h5-6,9-10H,7-8H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | YCTOCVMPRHDGRQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|