C14H24ClIN4O2S — CID 111319541
1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide (PubChem CID 111319541) has the molecular formula C14H24ClIN4O2S and a molecular weight of 474.80 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111319541 |
| Molecular Formula | C14H24ClIN4O2S |
| Molecular Weight | 474.80 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 1-[1-(2-chlorophenyl)ethyl]-3-ethyl-2-[2-(methanesulfonamido)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCNS(C)(=O)=O)NC(C)c1ccccc1Cl.I |
| InChI | InChI=1S/C14H23ClN4O2S.HI/c1-4-16-14(17-9-10-18-22(3,20)21)19-11(2)12-7-5-6-8-13(12)15;/h5-8,11,18H,4,9-10H2,1-3H3,(H2,16,17,19);1H |
| InChIKey | RTFCOWZYTJFPIV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.80 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|